C13H16O5 — CID 158297182
butan-1-ol;indene-1,2,3-trione;hydrate (PubChem CID 158297182) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is butan-1-ol;indene-1,2,3-trione;hydrate.
| Compound Name | butan-1-ol;indene-1,2,3-trione;hydrate |
|---|---|
| PubChem CID | 158297182 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | butan-1-ol;indene-1,2,3-trione;hydrate |
| SMILES | CCCCO.O.O=c1c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C9H4O3.C4H10O.H2O/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;1-2-3-4-5;/h1-4H;5H,2-4H2,1H3;1H2 |
| InChIKey | QYILKUYLKGLORV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|