About benzenesulfonic acid;butan-1-ol
benzenesulfonic acid;butan-1-ol (PubChem CID 174774031) has the molecular formula C10H16O4S
and a molecular weight of 232.30 g/mol. Its IUPAC name is benzenesulfonic acid;butan-1-ol.
Molecular Properties
| Compound Name | benzenesulfonic acid;butan-1-ol |
| PubChem CID | 174774031 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | benzenesulfonic acid;butan-1-ol |
| SMILES | CCCCO.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H10O/c7-10(8,9)6-4-2-1-3-5-6;1-2-3-4-5/h1-5H,(H,7,8,9);5H,2-4H2,1H3 |
| InChIKey | AEOFQSHCZTYUBD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;butan-1-ol?
The IUPAC name of benzenesulfonic acid;butan-1-ol (CID 174774031) is benzenesulfonic acid;butan-1-ol.
What is the SMILES notation for benzenesulfonic acid;butan-1-ol?
The canonical SMILES for benzenesulfonic acid;butan-1-ol is CCCCO.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;butan-1-ol?
The InChIKey is AEOFQSHCZTYUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.C4H10O/c7-10(8,9)6-4-2-1-3-5-6;1-2-3-4-5/h1-5H,(H,7,8,9);5H,2-4H2,1H3.
What are the key properties of benzenesulfonic acid;butan-1-ol?
benzenesulfonic acid;butan-1-ol has a molecular weight of 232.30 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;butan-1-ol is sourced from PubChem (CID 174774031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).