C14H18N2O3 — CID 162082726
1,2-bis(isocyanatomethyl)benzene;butan-1-ol (PubChem CID 162082726) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1,2-bis(isocyanatomethyl)benzene;butan-1-ol.
| Compound Name | 1,2-bis(isocyanatomethyl)benzene;butan-1-ol |
|---|---|
| PubChem CID | 162082726 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1,2-bis(isocyanatomethyl)benzene;butan-1-ol |
| SMILES | CCCCO.O=C=NCc1ccccc1CN=C=O |
| InChI | InChI=1S/C10H8N2O2.C4H10O/c13-7-11-5-9-3-1-2-4-10(9)6-12-8-14;1-2-3-4-5/h1-4H,5-6H2;5H,2-4H2,1H3 |
| InChIKey | ZCNYOVPSBLDKII-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|