About dichloroplatinum;oxo(diphenyl)phosphanium
dichloroplatinum;oxo(diphenyl)phosphanium (PubChem CID 174623297) has the molecular formula C12H10Cl2OPPt+
and a molecular weight of 467.17 g/mol. Its IUPAC name is dichloroplatinum;oxo(diphenyl)phosphanium.
Molecular Properties
| Compound Name | dichloroplatinum;oxo(diphenyl)phosphanium |
| PubChem CID | 174623297 |
| Molecular Formula | C12H10Cl2OPPt+ |
| Molecular Weight | 467.17 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | dichloroplatinum;oxo(diphenyl)phosphanium |
| SMILES | Cl[Pt]Cl.O=[P+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10OP.2ClH.Pt/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10H;2*1H;/q+1;;;+2/p-2 |
| InChIKey | ORKGUNZCAMUIPQ-UHFFFAOYSA-L |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;oxo(diphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;oxo(diphenyl)phosphanium?
The IUPAC name of dichloroplatinum;oxo(diphenyl)phosphanium (CID 174623297) is dichloroplatinum;oxo(diphenyl)phosphanium.
What is the SMILES notation for dichloroplatinum;oxo(diphenyl)phosphanium?
The canonical SMILES for dichloroplatinum;oxo(diphenyl)phosphanium is Cl[Pt]Cl.O=[P+](c1ccccc1)c1ccccc1.
What is the InChIKey of dichloroplatinum;oxo(diphenyl)phosphanium?
The InChIKey is ORKGUNZCAMUIPQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H10OP.2ClH.Pt/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10H;2*1H;/q+1;;;+2/p-2.
What are the key properties of dichloroplatinum;oxo(diphenyl)phosphanium?
dichloroplatinum;oxo(diphenyl)phosphanium has a molecular weight of 467.17 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;oxo(diphenyl)phosphanium is sourced from PubChem (CID 174623297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).