C20H24O2P+ — CID 141294399
oxo-(2,3,5,6-tetramethylphenyl)-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 141294399) has the molecular formula C20H24O2P+ and a molecular weight of 327.38 g/mol. Its IUPAC name is oxo-(2,3,5,6-tetramethylphenyl)-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | oxo-(2,3,5,6-tetramethylphenyl)-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 141294399 |
| Molecular Formula | C20H24O2P+ |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | oxo-(2,3,5,6-tetramethylphenyl)-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](=O)c2c(C)c(C)cc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C20H24O2P/c1-11-8-14(4)18(15(5)9-11)20(21)23(22)19-16(6)12(2)10-13(3)17(19)7/h8-10H,1-7H3/q+1 |
| InChIKey | DCPOHQQQWYVEAP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|