C12H16O2P+ — CID 54351714
methyl-oxo-(2,3,4,6-tetramethylbenzoyl)phosphanium (PubChem CID 54351714) has the molecular formula C12H16O2P+ and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl-oxo-(2,3,4,6-tetramethylbenzoyl)phosphanium.
| Compound Name | methyl-oxo-(2,3,4,6-tetramethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 54351714 |
| Molecular Formula | C12H16O2P+ |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | methyl-oxo-(2,3,4,6-tetramethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](C)=O)c(C)c1C |
| InChI | InChI=1S/C12H16O2P/c1-7-6-8(2)11(10(4)9(7)3)12(13)15(5)14/h6H,1-5H3/q+1 |
| InChIKey | LDGAIVDAZJVLOR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|