About [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate
[3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate (PubChem CID 174387260) has the molecular formula C24H30O3
and a molecular weight of 366.50 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate.
Molecular Properties
| Compound Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate |
| PubChem CID | 174387260 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate |
| SMILES | Cc1cc(C)c(C(=O)C(OC(=O)C(C)Cc2ccccc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C24H30O3/c1-15(2)23(22(25)21-17(4)12-16(3)13-18(21)5)27-24(26)19(6)14-20-10-8-7-9-11-20/h7-13,15,19,23H,14H2,1-6H3 |
| InChIKey | LXSCVXTYFIJALU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate?
The IUPAC name of [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate (CID 174387260) is [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate.
What is the SMILES notation for [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate?
The canonical SMILES for [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate is Cc1cc(C)c(C(=O)C(OC(=O)C(C)Cc2ccccc2)C(C)C)c(C)c1.
What is the InChIKey of [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate?
The InChIKey is LXSCVXTYFIJALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O3/c1-15(2)23(22(25)21-17(4)12-16(3)13-18(21)5)27-24(26)19(6)14-20-10-8-7-9-11-20/h7-13,15,19,23H,14H2,1-6H3.
What are the key properties of [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate?
[3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate has a molecular weight of 366.50 g/mol, XLogP of 5.24, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyl-3-phenylpropanoate is sourced from PubChem (CID 174387260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).