C19H29O4P — CID 174435600
[3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] pentanoate;oxophosphane (PubChem CID 174435600) has the molecular formula C19H29O4P and a molecular weight of 352.41 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] pentanoate;oxophosphane.
| Compound Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] pentanoate;oxophosphane |
|---|---|
| PubChem CID | 174435600 |
| Molecular Formula | C19H29O4P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] pentanoate;oxophosphane |
| SMILES | CCCCC(=O)OC(C(=O)c1c(C)cc(C)cc1C)C(C)C.O=P |
| InChI | InChI=1S/C19H28O3.HOP/c1-7-8-9-16(20)22-19(12(2)3)18(21)17-14(5)10-13(4)11-15(17)6;1-2/h10-12,19H,7-9H2,1-6H3;2H |
| InChIKey | GAEMLBVEIWJHKA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|