About (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate
(1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate (PubChem CID 58052162) has the molecular formula C19H36O4
and a molecular weight of 328.49 g/mol. Its IUPAC name is (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate.
Molecular Properties
| Compound Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate |
| PubChem CID | 58052162 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OC(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C19H36O4/c1-5-7-8-9-10-11-12-13-14-15-17(20)23-18(16(3)4)19(21)22-6-2/h16,18H,5-15H2,1-4H3 |
| InChIKey | AVHVZGXANSBVET-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate?
The IUPAC name of (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate (CID 58052162) is (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate.
What is the SMILES notation for (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate?
The canonical SMILES for (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate is CCCCCCCCCCCC(=O)OC(C(=O)OCC)C(C)C.
What is the InChIKey of (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate?
The InChIKey is AVHVZGXANSBVET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O4/c1-5-7-8-9-10-11-12-13-14-15-17(20)23-18(16(3)4)19(21)22-6-2/h16,18H,5-15H2,1-4H3.
What are the key properties of (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate?
(1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate has a molecular weight of 328.49 g/mol, XLogP of 5.04, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-3-methyl-1-oxobutan-2-yl) dodecanoate is sourced from PubChem (CID 58052162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).