C44H78O8 — CID 123527003
diethyl 2,3-di(octadec-9-enoyloxy)butanedioate (PubChem CID 123527003) has the molecular formula C44H78O8 and a molecular weight of 735.10 g/mol. Its IUPAC name is diethyl 2,3-di(octadec-9-enoyloxy)butanedioate.
| Compound Name | diethyl 2,3-di(octadec-9-enoyloxy)butanedioate |
|---|---|
| PubChem CID | 123527003 |
| Molecular Formula | C44H78O8 |
| Molecular Weight | 735.10 g/mol |
| Exact Mass | 734.57 |
| IUPAC Name | diethyl 2,3-di(octadec-9-enoyloxy)butanedioate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(C(=O)OCC)C(OC(=O)CCCCCCCC=CCCCCCCCC)C(=O)OCC |
| InChI | InChI=1S/C44H78O8/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39(45)51-41(43(47)49-7-3)42(44(48)50-8-4)52-40(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h21-24,41-42H,5-20,25-38H2,1-4H3 |
| InChIKey | IVFYAZGVXDSERP-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.10 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|