About (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate
(1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate (PubChem CID 130432169) has the molecular formula C23H42O4
and a molecular weight of 382.59 g/mol. Its IUPAC name is (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate.
Molecular Properties
| Compound Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate |
| PubChem CID | 130432169 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)OC(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C23H42O4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)27-22(20(3)4)23(25)26-6-2/h11-12,20,22H,5-10,13-19H2,1-4H3/b12-11+ |
| InChIKey | PUZZOKHFTBEQDJ-VAWYXSNFSA-N |
| XLogP | 6.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate?
The IUPAC name of (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate (CID 130432169) is (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate.
What is the SMILES notation for (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate?
The canonical SMILES for (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate is CCCCCC/C=C/CCCCCCCC(=O)OC(C(=O)OCC)C(C)C.
What is the InChIKey of (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate?
The InChIKey is PUZZOKHFTBEQDJ-VAWYXSNFSA-N. The full InChI is InChI=1S/C23H42O4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)27-22(20(3)4)23(25)26-6-2/h11-12,20,22H,5-10,13-19H2,1-4H3/b12-11+.
What are the key properties of (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate?
(1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate has a molecular weight of 382.59 g/mol, XLogP of 6.37, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-3-methyl-1-oxobutan-2-yl) (E)-hexadec-9-enoate is sourced from PubChem (CID 130432169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).