C42H46O5 — CID 141040043
2-[1,3-dioxo-1,3-bis(2,4,6-trimethylphenyl)propan-2-yl]oxy-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione (PubChem CID 141040043) has the molecular formula C42H46O5 and a molecular weight of 630.83 g/mol. Its IUPAC name is 2-[1,3-dioxo-1,3-bis(2,4,6-trimethylphenyl)propan-2-yl]oxy-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione.
| Compound Name | 2-[1,3-dioxo-1,3-bis(2,4,6-trimethylphenyl)propan-2-yl]oxy-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 141040043 |
| Molecular Formula | C42H46O5 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | 2-[1,3-dioxo-1,3-bis(2,4,6-trimethylphenyl)propan-2-yl]oxy-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)C(OC(C(=O)c2c(C)cc(C)cc2C)C(=O)c2c(C)cc(C)cc2C)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C42H46O5/c1-21-13-25(5)33(26(6)14-21)37(43)41(38(44)34-27(7)15-22(2)16-28(34)8)47-42(39(45)35-29(9)17-23(3)18-30(35)10)40(46)36-31(11)19-24(4)20-32(36)12/h13-20,41-42H,1-12H3 |
| InChIKey | AQJDFNMCAWUXQB-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|