C21H32O3 — CID 174386726
[3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] heptanoate (PubChem CID 174386726) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] heptanoate.
| Compound Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] heptanoate |
|---|---|
| PubChem CID | 174386726 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC(C(=O)c1c(C)cc(C)cc1C)C(C)C |
| InChI | InChI=1S/C21H32O3/c1-7-8-9-10-11-18(22)24-21(14(2)3)20(23)19-16(5)12-15(4)13-17(19)6/h12-14,21H,7-11H2,1-6H3 |
| InChIKey | SHJFCLJAOSVYCZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|