C38H40O6P+ — CID 172770545
(2,6-dimethoxybenzoyl)-oxo-[4-oxo-2-phenyl-3-(2,4,6-trimethylbenzoyl)-4-(2,4,6-trimethylphenyl)butyl]phosphanium (PubChem CID 172770545) has the molecular formula C38H40O6P+ and a molecular weight of 623.71 g/mol. Its IUPAC name is (2,6-dimethoxybenzoyl)-oxo-[4-oxo-2-phenyl-3-(2,4,6-trimethylbenzoyl)-4-(2,4,6-trimethylphenyl)butyl]phosphanium.
| Compound Name | (2,6-dimethoxybenzoyl)-oxo-[4-oxo-2-phenyl-3-(2,4,6-trimethylbenzoyl)-4-(2,4,6-trimethylphenyl)butyl]phosphanium |
|---|---|
| PubChem CID | 172770545 |
| Molecular Formula | C38H40O6P+ |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | (2,6-dimethoxybenzoyl)-oxo-[4-oxo-2-phenyl-3-(2,4,6-trimethylbenzoyl)-4-(2,4,6-trimethylphenyl)butyl]phosphanium |
| SMILES | COc1cccc(OC)c1C(=O)[P+](=O)CC(c1ccccc1)C(C(=O)c1c(C)cc(C)cc1C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C38H40O6P/c1-22-17-24(3)32(25(4)18-22)36(39)34(37(40)33-26(5)19-23(2)20-27(33)6)29(28-13-10-9-11-14-28)21-45(42)38(41)35-30(43-7)15-12-16-31(35)44-8/h9-20,29,34H,21H2,1-8H3/q+1 |
| InChIKey | HQKXUFYHOWLUHL-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|