About tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium
tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium (PubChem CID 158574727) has the molecular formula C22H28O4P+
and a molecular weight of 387.44 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium.
Molecular Properties
| Compound Name | tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium |
| PubChem CID | 158574727 |
| Molecular Formula | C22H28O4P+ |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium |
| SMILES | Cc1cc(C)c(C(=O)C(C(=O)OC(C)(C)C)c2ccccc2)c(C)c1.O=[PH2+] |
| InChI | InChI=1S/C22H26O3.H2OP/c1-14-12-15(2)18(16(3)13-14)20(23)19(17-10-8-7-9-11-17)21(24)25-22(4,5)6;1-2/h7-13,19H,1-6H3;2H2/q;+1 |
| InChIKey | DMNNWBOYSFZFGS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium?
The IUPAC name of tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium (CID 158574727) is tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium.
What is the SMILES notation for tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium?
The canonical SMILES for tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium is Cc1cc(C)c(C(=O)C(C(=O)OC(C)(C)C)c2ccccc2)c(C)c1.O=[PH2+].
What is the InChIKey of tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium?
The InChIKey is DMNNWBOYSFZFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O3.H2OP/c1-14-12-15(2)18(16(3)13-14)20(23)19(17-10-8-7-9-11-17)21(24)25-22(4,5)6;1-2/h7-13,19H,1-6H3;2H2/q;+1.
What are the key properties of tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium?
tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium has a molecular weight of 387.44 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate;oxophosphanium is sourced from PubChem (CID 158574727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).