C22H28N2O4 — CID 118294483
[(2R)-1-(carboxyamino)-4,4-dimethyl-1,6-diphenylhexan-2-yl]carbamic acid (PubChem CID 118294483) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(2R)-1-(carboxyamino)-4,4-dimethyl-1,6-diphenylhexan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-(carboxyamino)-4,4-dimethyl-1,6-diphenylhexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118294483 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(2R)-1-(carboxyamino)-4,4-dimethyl-1,6-diphenylhexan-2-yl]carbamic acid |
| SMILES | CC(C)(CCc1ccccc1)C[C@@H](NC(=O)O)C(NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O4/c1-22(2,14-13-16-9-5-3-6-10-16)15-18(23-20(25)26)19(24-21(27)28)17-11-7-4-8-12-17/h3-12,18-19,23-24H,13-15H2,1-2H3,(H,25,26)(H,27,28)/t18-,19?/m1/s1 |
| InChIKey | HWKDMNLKVFFMAM-MRTLOADZSA-N |
| XLogP | 4.68 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |