C15H21O7P — CID 70267801
2-[1-[hydroxy-[methoxy(phenyl)methyl]phosphoryl]ethyl]pentanedioic acid (PubChem CID 70267801) has the molecular formula C15H21O7P and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-[1-[hydroxy-[methoxy(phenyl)methyl]phosphoryl]ethyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy-[methoxy(phenyl)methyl]phosphoryl]ethyl]pentanedioic acid |
|---|---|
| PubChem CID | 70267801 |
| Molecular Formula | C15H21O7P |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[1-[hydroxy-[methoxy(phenyl)methyl]phosphoryl]ethyl]pentanedioic acid |
| SMILES | COC(c1ccccc1)P(=O)(O)C(C)C(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21O7P/c1-10(12(14(18)19)8-9-13(16)17)23(20,21)15(22-2)11-6-4-3-5-7-11/h3-7,10,12,15H,8-9H2,1-2H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | FTAVLEGHNGESNF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|