C16H21O7P — CID 54370789
2-[1-[hydroxy-[hydroxy(phenyl)methyl]phosphoryl]but-2-enyl]pentanedioic acid (PubChem CID 54370789) has the molecular formula C16H21O7P and a molecular weight of 356.31 g/mol. Its IUPAC name is 2-[1-[hydroxy-[hydroxy(phenyl)methyl]phosphoryl]but-2-enyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy-[hydroxy(phenyl)methyl]phosphoryl]but-2-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 54370789 |
| Molecular Formula | C16H21O7P |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[1-[hydroxy-[hydroxy(phenyl)methyl]phosphoryl]but-2-enyl]pentanedioic acid |
| SMILES | CC=CC(C(CCC(=O)O)C(=O)O)P(=O)(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H21O7P/c1-2-6-13(12(15(19)20)9-10-14(17)18)24(22,23)16(21)11-7-4-3-5-8-11/h2-8,12-13,16,21H,9-10H2,1H3,(H,17,18)(H,19,20)(H,22,23) |
| InChIKey | UTAXKAHWANBGHG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|