C19H24NO6P — CID 18403161
2-[[hydroxy(1-naphthalen-1-ylbutyl)phosphoryl]amino]pentanedioic acid (PubChem CID 18403161) has the molecular formula C19H24NO6P and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-[[hydroxy(1-naphthalen-1-ylbutyl)phosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[hydroxy(1-naphthalen-1-ylbutyl)phosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18403161 |
| Molecular Formula | C19H24NO6P |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[[hydroxy(1-naphthalen-1-ylbutyl)phosphoryl]amino]pentanedioic acid |
| SMILES | CCCC(c1cccc2ccccc12)P(=O)(O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H24NO6P/c1-2-6-17(15-10-5-8-13-7-3-4-9-14(13)15)27(25,26)20-16(19(23)24)11-12-18(21)22/h3-5,7-10,16-17H,2,6,11-12H2,1H3,(H,21,22)(H,23,24)(H2,20,25,26) |
| InChIKey | MVFKYJRJOHAUPP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|