C22H29O6P — CID 19357811
2-[1-[hydroxy(naphthalen-1-yl)phosphoryl]heptyl]pentanedioic acid (PubChem CID 19357811) has the molecular formula C22H29O6P and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-[1-[hydroxy(naphthalen-1-yl)phosphoryl]heptyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy(naphthalen-1-yl)phosphoryl]heptyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357811 |
| Molecular Formula | C22H29O6P |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[1-[hydroxy(naphthalen-1-yl)phosphoryl]heptyl]pentanedioic acid |
| SMILES | CCCCCCC(C(CCC(=O)O)C(=O)O)P(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H29O6P/c1-2-3-4-5-12-20(18(22(25)26)14-15-21(23)24)29(27,28)19-13-8-10-16-9-6-7-11-17(16)19/h6-11,13,18,20H,2-5,12,14-15H2,1H3,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | LYNIUGOOSVAYEE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|