C23H34NO6P — CID 54469039
2-[1-[hydroxy-[3-(1H-indol-3-yl)propyl]phosphoryl]heptyl]pentanedioic acid (PubChem CID 54469039) has the molecular formula C23H34NO6P and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-[1-[hydroxy-[3-(1H-indol-3-yl)propyl]phosphoryl]heptyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy-[3-(1H-indol-3-yl)propyl]phosphoryl]heptyl]pentanedioic acid |
|---|---|
| PubChem CID | 54469039 |
| Molecular Formula | C23H34NO6P |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[1-[hydroxy-[3-(1H-indol-3-yl)propyl]phosphoryl]heptyl]pentanedioic acid |
| SMILES | CCCCCCC(C(CCC(=O)O)C(=O)O)P(=O)(O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H34NO6P/c1-2-3-4-5-12-21(19(23(27)28)13-14-22(25)26)31(29,30)15-8-9-17-16-24-20-11-7-6-10-18(17)20/h6-7,10-11,16,19,21,24H,2-5,8-9,12-15H2,1H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | XGZPMDKVCVBMGK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|