About 1H-indol-3-ol;octadecanoic acid
1H-indol-3-ol;octadecanoic acid (PubChem CID 22916327) has the molecular formula C26H43NO3
and a molecular weight of 417.63 g/mol. Its IUPAC name is 1H-indol-3-ol;octadecanoic acid.
Molecular Properties
| Compound Name | 1H-indol-3-ol;octadecanoic acid |
| PubChem CID | 22916327 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | 1H-indol-3-ol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.Oc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H36O2.C8H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;10-8-5-9-7-4-2-1-3-6(7)8/h2-17H2,1H3,(H,19,20);1-5,9-10H |
| InChIKey | XLBYJGSSSCZLJS-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-indol-3-ol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-ol;octadecanoic acid?
The IUPAC name of 1H-indol-3-ol;octadecanoic acid (CID 22916327) is 1H-indol-3-ol;octadecanoic acid.
What is the SMILES notation for 1H-indol-3-ol;octadecanoic acid?
The canonical SMILES for 1H-indol-3-ol;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.Oc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-ol;octadecanoic acid?
The InChIKey is XLBYJGSSSCZLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C8H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;10-8-5-9-7-4-2-1-3-6(7)8/h2-17H2,1H3,(H,19,20);1-5,9-10H.
What are the key properties of 1H-indol-3-ol;octadecanoic acid?
1H-indol-3-ol;octadecanoic acid has a molecular weight of 417.63 g/mol, XLogP of 8.21, 16 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-ol;octadecanoic acid is sourced from PubChem (CID 22916327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).