About 6-bromo-1H-indol-3-ol;octanoic acid
6-bromo-1H-indol-3-ol;octanoic acid (PubChem CID 174613949) has the molecular formula C16H22BrNO3
and a molecular weight of 356.26 g/mol. Its IUPAC name is 6-bromo-1H-indol-3-ol;octanoic acid.
Molecular Properties
| Compound Name | 6-bromo-1H-indol-3-ol;octanoic acid |
| PubChem CID | 174613949 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-bromo-1H-indol-3-ol;octanoic acid |
| SMILES | CCCCCCCC(=O)O.Oc1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C8H6BrNO.C8H16O2/c9-5-1-2-6-7(3-5)10-4-8(6)11;1-2-3-4-5-6-7-8(9)10/h1-4,10-11H;2-7H2,1H3,(H,9,10) |
| InChIKey | ARSCUNZNTGWTHZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-indol-3-ol;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-indol-3-ol;octanoic acid?
The IUPAC name of 6-bromo-1H-indol-3-ol;octanoic acid (CID 174613949) is 6-bromo-1H-indol-3-ol;octanoic acid.
What is the SMILES notation for 6-bromo-1H-indol-3-ol;octanoic acid?
The canonical SMILES for 6-bromo-1H-indol-3-ol;octanoic acid is CCCCCCCC(=O)O.Oc1c[nH]c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1H-indol-3-ol;octanoic acid?
The InChIKey is ARSCUNZNTGWTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO.C8H16O2/c9-5-1-2-6-7(3-5)10-4-8(6)11;1-2-3-4-5-6-7-8(9)10/h1-4,10-11H;2-7H2,1H3,(H,9,10).
What are the key properties of 6-bromo-1H-indol-3-ol;octanoic acid?
6-bromo-1H-indol-3-ol;octanoic acid has a molecular weight of 356.26 g/mol, XLogP of 5.07, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-indol-3-ol;octanoic acid is sourced from PubChem (CID 174613949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).