About 1-bromo-4-fluorobenzene;pentanoic acid
1-bromo-4-fluorobenzene;pentanoic acid (PubChem CID 175420474) has the molecular formula C11H14BrFO2
and a molecular weight of 277.13 g/mol. Its IUPAC name is 1-bromo-4-fluorobenzene;pentanoic acid.
Molecular Properties
| Compound Name | 1-bromo-4-fluorobenzene;pentanoic acid |
| PubChem CID | 175420474 |
| Molecular Formula | C11H14BrFO2 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-bromo-4-fluorobenzene;pentanoic acid |
| SMILES | CCCCC(=O)O.Fc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H4BrF.C5H10O2/c7-5-1-3-6(8)4-2-5;1-2-3-4-5(6)7/h1-4H;2-4H2,1H3,(H,6,7) |
| InChIKey | IOFUSNQWRIFTLP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-fluorobenzene;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-fluorobenzene;pentanoic acid?
The IUPAC name of 1-bromo-4-fluorobenzene;pentanoic acid (CID 175420474) is 1-bromo-4-fluorobenzene;pentanoic acid.
What is the SMILES notation for 1-bromo-4-fluorobenzene;pentanoic acid?
The canonical SMILES for 1-bromo-4-fluorobenzene;pentanoic acid is CCCCC(=O)O.Fc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-fluorobenzene;pentanoic acid?
The InChIKey is IOFUSNQWRIFTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF.C5H10O2/c7-5-1-3-6(8)4-2-5;1-2-3-4-5(6)7/h1-4H;2-4H2,1H3,(H,6,7).
What are the key properties of 1-bromo-4-fluorobenzene;pentanoic acid?
1-bromo-4-fluorobenzene;pentanoic acid has a molecular weight of 277.13 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-fluorobenzene;pentanoic acid is sourced from PubChem (CID 175420474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).