C10H11BrO2 — CID 50940550
4-(4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)butanoic acid (PubChem CID 50940550) has the molecular formula C10H11BrO2 and a molecular weight of 249.05 g/mol. Its IUPAC name is 4-(4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)butanoic acid.
| Compound Name | 4-(4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)butanoic acid |
|---|---|
| PubChem CID | 50940550 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-(4-bromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)butanoic acid |
| SMILES | O=C(O)CCC[13c]1[13cH][13cH][13c](Br)[13cH][13cH]1 |
| InChI | InChI=1S/C10H11BrO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)/i4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | AGIIMNQWNPUJPT-VFESMUGCSA-N |
| XLogP | 2.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |