C12H16BrNO — CID 158418152
4-(4-bromophenyl)-N,N-dimethylbutanamide (PubChem CID 158418152) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N,N-dimethylbutanamide.
| Compound Name | 4-(4-bromophenyl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 158418152 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-(4-bromophenyl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H16BrNO/c1-14(2)12(15)5-3-4-10-6-8-11(13)9-7-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | RBTFRTUFRYVYAF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |