About 6-bromo-1H-indol-3-ol;phosphoric acid
6-bromo-1H-indol-3-ol;phosphoric acid (PubChem CID 135389689) has the molecular formula C8H9BrNO5P
and a molecular weight of 310.04 g/mol. Its IUPAC name is 6-bromo-1H-indol-3-ol;phosphoric acid.
Molecular Properties
| Compound Name | 6-bromo-1H-indol-3-ol;phosphoric acid |
| PubChem CID | 135389689 |
| Molecular Formula | C8H9BrNO5P |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 308.94 |
| IUPAC Name | 6-bromo-1H-indol-3-ol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C8H6BrNO.H3O4P/c9-5-1-2-6-7(3-5)10-4-8(6)11;1-5(2,3)4/h1-4,10-11H;(H3,1,2,3,4) |
| InChIKey | LIRPMZBBRBIGDV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-indol-3-ol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-indol-3-ol;phosphoric acid?
The IUPAC name of 6-bromo-1H-indol-3-ol;phosphoric acid (CID 135389689) is 6-bromo-1H-indol-3-ol;phosphoric acid.
What is the SMILES notation for 6-bromo-1H-indol-3-ol;phosphoric acid?
The canonical SMILES for 6-bromo-1H-indol-3-ol;phosphoric acid is O=P(O)(O)O.Oc1c[nH]c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1H-indol-3-ol;phosphoric acid?
The InChIKey is LIRPMZBBRBIGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO.H3O4P/c9-5-1-2-6-7(3-5)10-4-8(6)11;1-5(2,3)4/h1-4,10-11H;(H3,1,2,3,4).
What are the key properties of 6-bromo-1H-indol-3-ol;phosphoric acid?
6-bromo-1H-indol-3-ol;phosphoric acid has a molecular weight of 310.04 g/mol, XLogP of 1.71, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-indol-3-ol;phosphoric acid is sourced from PubChem (CID 135389689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).