About 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde
6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde (PubChem CID 157347826) has the molecular formula C17H12Br2N2O
and a molecular weight of 420.10 g/mol. Its IUPAC name is 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde |
| PubChem CID | 157347826 |
| Molecular Formula | C17H12Br2N2O |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.93 |
| IUPAC Name | 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde |
| SMILES | Brc1ccc2cc[nH]c2c1.O=Cc1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C9H6BrNO.C8H6BrN/c10-7-1-2-8-6(5-12)4-11-9(8)3-7;9-7-2-1-6-3-4-10-8(6)5-7/h1-5,11H;1-5,10H |
| InChIKey | BHEJBTVUBDDELM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde?
The IUPAC name of 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde (CID 157347826) is 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde.
What is the SMILES notation for 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde?
The canonical SMILES for 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde is Brc1ccc2cc[nH]c2c1.O=Cc1c[nH]c2cc(Br)ccc12.
What is the InChIKey of 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde?
The InChIKey is BHEJBTVUBDDELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO.C8H6BrN/c10-7-1-2-8-6(5-12)4-11-9(8)3-7;9-7-2-1-6-3-4-10-8(6)5-7/h1-5,11H;1-5,10H.
What are the key properties of 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde?
6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde has a molecular weight of 420.10 g/mol, XLogP of 5.67, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-indole;6-bromo-1H-indole-3-carbaldehyde is sourced from PubChem (CID 157347826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).