C10H6Br3NO — CID 135045023
2,2-dibromo-1-(6-bromo-1H-indol-3-yl)ethanone (PubChem CID 135045023) has the molecular formula C10H6Br3NO and a molecular weight of 395.88 g/mol. Its IUPAC name is 2,2-dibromo-1-(6-bromo-1H-indol-3-yl)ethanone.
| Compound Name | 2,2-dibromo-1-(6-bromo-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 135045023 |
| Molecular Formula | C10H6Br3NO |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 392.80 |
| IUPAC Name | 2,2-dibromo-1-(6-bromo-1H-indol-3-yl)ethanone |
| SMILES | O=C(c1c[nH]c2cc(Br)ccc12)C(Br)Br |
| InChI | InChI=1S/C10H6Br3NO/c11-5-1-2-6-7(9(15)10(12)13)4-14-8(6)3-5/h1-4,10,14H |
| InChIKey | OTXOXEYFANMIAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|