C15H12BrNOS — CID 65237633
(6-bromo-1H-indol-3-yl)-(4,5-dimethylthiophen-2-yl)methanone (PubChem CID 65237633) has the molecular formula C15H12BrNOS and a molecular weight of 334.24 g/mol. Its IUPAC name is (6-bromo-1H-indol-3-yl)-(4,5-dimethylthiophen-2-yl)methanone.
| Compound Name | (6-bromo-1H-indol-3-yl)-(4,5-dimethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 65237633 |
| Molecular Formula | C15H12BrNOS |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (6-bromo-1H-indol-3-yl)-(4,5-dimethylthiophen-2-yl)methanone |
| SMILES | Cc1cc(C(=O)c2c[nH]c3cc(Br)ccc23)sc1C |
| InChI | InChI=1S/C15H12BrNOS/c1-8-5-14(19-9(8)2)15(18)12-7-17-13-6-10(16)3-4-11(12)13/h3-7,17H,1-2H3 |
| InChIKey | BNXWSISWGQZGSS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |