C12H9BrN2O2 — CID 15416729
6-bromo-3-[(1E,3E)-4-nitrobuta-1,3-dienyl]-1H-indole (PubChem CID 15416729) has the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. Its IUPAC name is 6-bromo-3-[(1E,3E)-4-nitrobuta-1,3-dienyl]-1H-indole.
| Compound Name | 6-bromo-3-[(1E,3E)-4-nitrobuta-1,3-dienyl]-1H-indole |
|---|---|
| PubChem CID | 15416729 |
| Molecular Formula | C12H9BrN2O2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 6-bromo-3-[(1E,3E)-4-nitrobuta-1,3-dienyl]-1H-indole |
| SMILES | O=[N+]([O-])/C=C/C=C/c1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C12H9BrN2O2/c13-10-4-5-11-9(8-14-12(11)7-10)3-1-2-6-15(16)17/h1-8,14H/b3-1+,6-2+ |
| InChIKey | PQFVKBIBLRTJAC-DHWRHDBVSA-N |
| XLogP | 3.73 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|