About 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid
5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid (PubChem CID 66684871) has the molecular formula C24H37BrClNO3
and a molecular weight of 502.92 g/mol. Its IUPAC name is 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid.
Molecular Properties
| Compound Name | 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid |
| PubChem CID | 66684871 |
| Molecular Formula | C24H37BrClNO3 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.Oc1c[nH]c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C16H32O2.C8H5BrClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;9-5-1-4-7(2-6(5)10)11-3-8(4)12/h2-15H2,1H3,(H,17,18);1-3,11-12H |
| InChIKey | SWFCCJDNQQBOHL-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid?
The IUPAC name of 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid (CID 66684871) is 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid.
What is the SMILES notation for 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid?
The canonical SMILES for 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid is CCCCCCCCCCCCCCCC(=O)O.Oc1c[nH]c2cc(Cl)c(Br)cc12.
What is the InChIKey of 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid?
The InChIKey is SWFCCJDNQQBOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C8H5BrClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;9-5-1-4-7(2-6(5)10)11-3-8(4)12/h2-15H2,1H3,(H,17,18);1-3,11-12H.
What are the key properties of 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid?
5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid has a molecular weight of 502.92 g/mol, XLogP of 8.84, 14 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloro-1H-indol-3-ol;hexadecanoic acid is sourced from PubChem (CID 66684871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).