About butanoic acid;tetradecanoic acid
butanoic acid;tetradecanoic acid (PubChem CID 157185085) has the molecular formula C18H36O4
and a molecular weight of 316.48 g/mol. Its IUPAC name is butanoic acid;tetradecanoic acid.
Molecular Properties
| Compound Name | butanoic acid;tetradecanoic acid |
| PubChem CID | 157185085 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | butanoic acid;tetradecanoic acid |
| SMILES | CCCC(=O)O.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.C4H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4(5)6/h2-13H2,1H3,(H,15,16);2-3H2,1H3,(H,5,6) |
| InChIKey | APAHZUATBJKTSN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butanoic acid;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;tetradecanoic acid?
The IUPAC name of butanoic acid;tetradecanoic acid (CID 157185085) is butanoic acid;tetradecanoic acid.
What is the SMILES notation for butanoic acid;tetradecanoic acid?
The canonical SMILES for butanoic acid;tetradecanoic acid is CCCC(=O)O.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of butanoic acid;tetradecanoic acid?
The InChIKey is APAHZUATBJKTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C4H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-2-3-4(5)6/h2-13H2,1H3,(H,15,16);2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;tetradecanoic acid?
butanoic acid;tetradecanoic acid has a molecular weight of 316.48 g/mol, XLogP of 5.64, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;tetradecanoic acid is sourced from PubChem (CID 157185085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).