About 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid
5-bromo-6-chloro-1H-indol-3-ol;butanoic acid (PubChem CID 66685115) has the molecular formula C12H13BrClNO3
and a molecular weight of 334.60 g/mol. Its IUPAC name is 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid.
Molecular Properties
| Compound Name | 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid |
| PubChem CID | 66685115 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid |
| SMILES | CCCC(=O)O.Oc1c[nH]c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C8H5BrClNO.C4H8O2/c9-5-1-4-7(2-6(5)10)11-3-8(4)12;1-2-3-4(5)6/h1-3,11-12H;2-3H2,1H3,(H,5,6) |
| InChIKey | RGJJYSAFOUMCDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid?
The IUPAC name of 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid (CID 66685115) is 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid.
What is the SMILES notation for 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid?
The canonical SMILES for 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid is CCCC(=O)O.Oc1c[nH]c2cc(Cl)c(Br)cc12.
What is the InChIKey of 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid?
The InChIKey is RGJJYSAFOUMCDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrClNO.C4H8O2/c9-5-1-4-7(2-6(5)10)11-3-8(4)12;1-2-3-4(5)6/h1-3,11-12H;2-3H2,1H3,(H,5,6).
What are the key properties of 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid?
5-bromo-6-chloro-1H-indol-3-ol;butanoic acid has a molecular weight of 334.60 g/mol, XLogP of 4.16, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloro-1H-indol-3-ol;butanoic acid is sourced from PubChem (CID 66685115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).