C11H9Cl2NO2S — CID 57240301
2-[(5,6-dichloro-1H-indol-3-yl)methylsulfanyl]acetic acid (PubChem CID 57240301) has the molecular formula C11H9Cl2NO2S and a molecular weight of 290.17 g/mol. Its IUPAC name is 2-[(5,6-dichloro-1H-indol-3-yl)methylsulfanyl]acetic acid.
| Compound Name | 2-[(5,6-dichloro-1H-indol-3-yl)methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57240301 |
| Molecular Formula | C11H9Cl2NO2S |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2-[(5,6-dichloro-1H-indol-3-yl)methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1c[nH]c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C11H9Cl2NO2S/c12-8-1-7-6(4-17-5-11(15)16)3-14-10(7)2-9(8)13/h1-3,14H,4-5H2,(H,15,16) |
| InChIKey | AUEHXDQKJZNESL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |