C15H12Cl2O3S — CID 66573806
2-[[4-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetic acid (PubChem CID 66573806) has the molecular formula C15H12Cl2O3S and a molecular weight of 343.23 g/mol. Its IUPAC name is 2-[[4-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[4-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 66573806 |
| Molecular Formula | C15H12Cl2O3S |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2-[[4-(3,4-dichlorophenoxy)phenyl]methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2O3S/c16-13-6-5-12(7-14(13)17)20-11-3-1-10(2-4-11)8-21-9-15(18)19/h1-7H,8-9H2,(H,18,19) |
| InChIKey | NEHBJCYUMJVOGX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |