C15H12Cl2O4S — CID 129364945
2-[(S)-[4-(3,4-dichlorophenoxy)phenyl]methylsulfinyl]acetic acid (PubChem CID 129364945) has the molecular formula C15H12Cl2O4S and a molecular weight of 359.23 g/mol. Its IUPAC name is 2-[(S)-[4-(3,4-dichlorophenoxy)phenyl]methylsulfinyl]acetic acid.
| Compound Name | 2-[(S)-[4-(3,4-dichlorophenoxy)phenyl]methylsulfinyl]acetic acid |
|---|---|
| PubChem CID | 129364945 |
| Molecular Formula | C15H12Cl2O4S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-[(S)-[4-(3,4-dichlorophenoxy)phenyl]methylsulfinyl]acetic acid |
| SMILES | O=C(O)C[S@@](=O)Cc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2O4S/c16-13-6-5-12(7-14(13)17)21-11-3-1-10(2-4-11)8-22(20)9-15(18)19/h1-7H,8-9H2,(H,18,19)/t22-/m0/s1 |
| InChIKey | FDJMAVBSJLLVAX-QFIPXVFZSA-N |
| XLogP | 4.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |