C11H12Cl2O3S — CID 123108575
4-[(3,4-dichlorophenyl)methylsulfinyl]butanoic acid (PubChem CID 123108575) has the molecular formula C11H12Cl2O3S and a molecular weight of 295.19 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfinyl]butanoic acid.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 123108575 |
| Molecular Formula | C11H12Cl2O3S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfinyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2O3S/c12-9-4-3-8(6-10(9)13)7-17(16)5-1-2-11(14)15/h3-4,6H,1-2,5,7H2,(H,14,15) |
| InChIKey | UWPAYPMAXZMKPV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |