C13H8Cl2NO3- — CID 23451749
N-[4-(3,4-dichlorophenoxy)phenyl]carbamate (PubChem CID 23451749) has the molecular formula C13H8Cl2NO3- and a molecular weight of 297.12 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenoxy)phenyl]carbamate.
| Compound Name | N-[4-(3,4-dichlorophenoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 23451749 |
| Molecular Formula | C13H8Cl2NO3- |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | N-[4-(3,4-dichlorophenoxy)phenyl]carbamate |
| SMILES | O=C([O-])Nc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H9Cl2NO3/c14-11-6-5-10(7-12(11)15)19-9-3-1-8(2-4-9)16-13(17)18/h1-7,16H,(H,17,18)/p-1 |
| InChIKey | ZMKSJNVGINZGKC-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |