C10H6Cl2NO3- — CID 4065684
4-(3,4-dichloroanilino)-4-oxobut-2-enoate (PubChem CID 4065684) has the molecular formula C10H6Cl2NO3- and a molecular weight of 259.07 g/mol. Its IUPAC name is 4-(3,4-dichloroanilino)-4-oxobut-2-enoate.
| Compound Name | 4-(3,4-dichloroanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4065684 |
| Molecular Formula | C10H6Cl2NO3- |
| Molecular Weight | 259.07 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 4-(3,4-dichloroanilino)-4-oxobut-2-enoate |
| SMILES | O=C([O-])C=CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2NO3/c11-7-2-1-6(5-8(7)12)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/p-1 |
| InChIKey | YMYKNYVBUCMJOG-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.07 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|