C18H14ClN2O4- — CID 2278100
(Z)-4-[4-chloro-3-[(2-phenylacetyl)amino]anilino]-4-oxobut-2-enoate (PubChem CID 2278100) has the molecular formula C18H14ClN2O4- and a molecular weight of 357.77 g/mol. Its IUPAC name is (Z)-4-[4-chloro-3-[(2-phenylacetyl)amino]anilino]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-[4-chloro-3-[(2-phenylacetyl)amino]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2278100 |
| Molecular Formula | C18H14ClN2O4- |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (Z)-4-[4-chloro-3-[(2-phenylacetyl)amino]anilino]-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C\C(=O)Nc1ccc(Cl)c(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-14-7-6-13(20-16(22)8-9-18(24)25)11-15(14)21-17(23)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,20,22)(H,21,23)(H,24,25)/p-1/b9-8- |
| InChIKey | ORTJPPGTMDZQLP-HJWRWDBZSA-M |
| XLogP | 1.77 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|