C11H7N2O4- — CID 7015274
(E)-4-(1,3-benzoxazol-6-ylamino)-4-oxobut-2-enoate (PubChem CID 7015274) has the molecular formula C11H7N2O4- and a molecular weight of 231.19 g/mol. Its IUPAC name is (E)-4-(1,3-benzoxazol-6-ylamino)-4-oxobut-2-enoate.
| Compound Name | (E)-4-(1,3-benzoxazol-6-ylamino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7015274 |
| Molecular Formula | C11H7N2O4- |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | (E)-4-(1,3-benzoxazol-6-ylamino)-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)Nc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H8N2O4/c14-10(3-4-11(15)16)13-7-1-2-8-9(5-7)17-6-12-8/h1-6H,(H,13,14)(H,15,16)/p-1/b4-3+ |
| InChIKey | GJGKHXQRSGZBLY-ONEGZZNKSA-M |
| XLogP | 0.07 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|