C15H11Cl2NO2 — CID 69127655
N-(3,4-dichlorophenyl)-3-phenoxyprop-2-enamide (PubChem CID 69127655) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-phenoxyprop-2-enamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-phenoxyprop-2-enamide |
|---|---|
| PubChem CID | 69127655 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-phenoxyprop-2-enamide |
| SMILES | O=C(C=COc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2NO2/c16-13-7-6-11(10-14(13)17)18-15(19)8-9-20-12-4-2-1-3-5-12/h1-10H,(H,18,19) |
| InChIKey | YOGHXQWTMDLJAJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|