C14H12Cl2O2S — CID 129390999
1,2-dichloro-4-[4-[[(R)-methylsulfinyl]methyl]phenoxy]benzene (PubChem CID 129390999) has the molecular formula C14H12Cl2O2S and a molecular weight of 315.22 g/mol. Its IUPAC name is 1,2-dichloro-4-[4-[[(R)-methylsulfinyl]methyl]phenoxy]benzene.
| Compound Name | 1,2-dichloro-4-[4-[[(R)-methylsulfinyl]methyl]phenoxy]benzene |
|---|---|
| PubChem CID | 129390999 |
| Molecular Formula | C14H12Cl2O2S |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 1,2-dichloro-4-[4-[[(R)-methylsulfinyl]methyl]phenoxy]benzene |
| SMILES | C[S@@](=O)Cc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H12Cl2O2S/c1-19(17)9-10-2-4-11(5-3-10)18-12-6-7-13(15)14(16)8-12/h2-8H,9H2,1H3/t19-/m1/s1 |
| InChIKey | GCZYLJZKRHVXTO-LJQANCHMSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |