C15H15Cl2NO2S — CID 141036025
2-[2-(3,4-dichlorophenoxy)-5-methylsulfinylphenyl]ethanamine (PubChem CID 141036025) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenoxy)-5-methylsulfinylphenyl]ethanamine.
| Compound Name | 2-[2-(3,4-dichlorophenoxy)-5-methylsulfinylphenyl]ethanamine |
|---|---|
| PubChem CID | 141036025 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[2-(3,4-dichlorophenoxy)-5-methylsulfinylphenyl]ethanamine |
| SMILES | CS(=O)c1ccc(Oc2ccc(Cl)c(Cl)c2)c(CCN)c1 |
| InChI | InChI=1S/C15H15Cl2NO2S/c1-21(19)12-3-5-15(10(8-12)6-7-18)20-11-2-4-13(16)14(17)9-11/h2-5,8-9H,6-7,18H2,1H3 |
| InChIKey | GXSGITVPPGZEQG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |