C14H14ClFN2O3S — CID 154573621
3-(2-aminoethyl)-4-(3-chloro-4-fluorophenoxy)benzenesulfonamide (PubChem CID 154573621) has the molecular formula C14H14ClFN2O3S and a molecular weight of 344.80 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4-(3-chloro-4-fluorophenoxy)benzenesulfonamide.
| Compound Name | 3-(2-aminoethyl)-4-(3-chloro-4-fluorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 154573621 |
| Molecular Formula | C14H14ClFN2O3S |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-(2-aminoethyl)-4-(3-chloro-4-fluorophenoxy)benzenesulfonamide |
| SMILES | NCCc1cc(S(N)(=O)=O)ccc1Oc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H14ClFN2O3S/c15-12-8-10(1-3-13(12)16)21-14-4-2-11(22(18,19)20)7-9(14)5-6-17/h1-4,7-8H,5-6,17H2,(H2,18,19,20) |
| InChIKey | WDVWTPNEVTYLQC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |