C13H11F2NO3S — CID 114276763
4-(4,5-difluoro-2-methylphenoxy)benzenesulfonamide (PubChem CID 114276763) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-(4,5-difluoro-2-methylphenoxy)benzenesulfonamide.
| Compound Name | 4-(4,5-difluoro-2-methylphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 114276763 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-(4,5-difluoro-2-methylphenoxy)benzenesulfonamide |
| SMILES | Cc1cc(F)c(F)cc1Oc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H11F2NO3S/c1-8-6-11(14)12(15)7-13(8)19-9-2-4-10(5-3-9)20(16,17)18/h2-7H,1H3,(H2,16,17,18) |
| InChIKey | VMDRUURKQJUWDN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |