C13H13FN2O3S — CID 82900296
4-amino-3-(4-fluoro-3-methylphenoxy)benzenesulfonamide (PubChem CID 82900296) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-amino-3-(4-fluoro-3-methylphenoxy)benzenesulfonamide.
| Compound Name | 4-amino-3-(4-fluoro-3-methylphenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82900296 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-amino-3-(4-fluoro-3-methylphenoxy)benzenesulfonamide |
| SMILES | Cc1cc(Oc2cc(S(N)(=O)=O)ccc2N)ccc1F |
| InChI | InChI=1S/C13H13FN2O3S/c1-8-6-9(2-4-11(8)14)19-13-7-10(20(16,17)18)3-5-12(13)15/h2-7H,15H2,1H3,(H2,16,17,18) |
| InChIKey | UZZAZIOOXQLUEO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|