C13H12F2N2O3S — CID 79902338
5-amino-3-(3,4-difluorophenoxy)-2-methylbenzenesulfonamide (PubChem CID 79902338) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is 5-amino-3-(3,4-difluorophenoxy)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-(3,4-difluorophenoxy)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79902338 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-amino-3-(3,4-difluorophenoxy)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Oc2ccc(F)c(F)c2)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H12F2N2O3S/c1-7-12(4-8(16)5-13(7)21(17,18)19)20-9-2-3-10(14)11(15)6-9/h2-6H,16H2,1H3,(H2,17,18,19) |
| InChIKey | JWNBJHOIZSPHOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|