C13H11Cl2NO3S — CID 43436524
4-(2,5-dichlorophenoxy)-2-methylbenzenesulfonamide (PubChem CID 43436524) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is 4-(2,5-dichlorophenoxy)-2-methylbenzenesulfonamide.
| Compound Name | 4-(2,5-dichlorophenoxy)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43436524 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 4-(2,5-dichlorophenoxy)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Oc2cc(Cl)ccc2Cl)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H11Cl2NO3S/c1-8-6-10(3-5-13(8)20(16,17)18)19-12-7-9(14)2-4-11(12)15/h2-7H,1H3,(H2,16,17,18) |
| InChIKey | VUNVPOKACOBJFO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |